C18H11ClN2O3S2 — CID 41340432
2-(5-chlorothiophen-2-yl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 41340432) has the molecular formula C18H11ClN2O3S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 41340432 |
| Molecular Formula | C18H11ClN2O3S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)s1)Nc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C18H11ClN2O3S2/c19-15-6-5-11(26-15)8-16(22)21-18-20-13(9-25-18)12-7-10-3-1-2-4-14(10)24-17(12)23/h1-7,9H,8H2,(H,20,21,22) |
| InChIKey | YQLSDHDUVQYNHW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|