C14H10N2O3S — CID 705931
2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 705931) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 705931 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | NC(=O)Cc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C14H10N2O3S/c15-12(17)6-13-16-10(7-20-13)9-5-8-3-1-2-4-11(8)19-14(9)18/h1-5,7H,6H2,(H2,15,17) |
| InChIKey | BJNXCXJNETXMGX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|