C11H6N2O3 — CID 141396662
3-(1,2,5-oxadiazol-3-yl)chromen-2-one (PubChem CID 141396662) has the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-(1,2,5-oxadiazol-3-yl)chromen-2-one.
| Compound Name | 3-(1,2,5-oxadiazol-3-yl)chromen-2-one |
|---|---|
| PubChem CID | 141396662 |
| Molecular Formula | C11H6N2O3 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-(1,2,5-oxadiazol-3-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cnon1 |
| InChI | InChI=1S/C11H6N2O3/c14-11-8(9-6-12-16-13-9)5-7-3-1-2-4-10(7)15-11/h1-6H |
| InChIKey | TWRWGIFERFGPJI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|