C22H13NO4 — CID 987607
4-methyl-2-(2-oxochromen-3-yl)chromeno[4,3-b]pyridin-5-one (PubChem CID 987607) has the molecular formula C22H13NO4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-methyl-2-(2-oxochromen-3-yl)chromeno[4,3-b]pyridin-5-one.
| Compound Name | 4-methyl-2-(2-oxochromen-3-yl)chromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 987607 |
| Molecular Formula | C22H13NO4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-methyl-2-(2-oxochromen-3-yl)chromeno[4,3-b]pyridin-5-one |
| SMILES | Cc1cc(-c2cc3ccccc3oc2=O)nc2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C22H13NO4/c1-12-10-16(15-11-13-6-2-4-8-17(13)26-21(15)24)23-20-14-7-3-5-9-18(14)27-22(25)19(12)20/h2-11H,1H3 |
| InChIKey | LMBDKKRQADAJOH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|