C14H10O4 — CID 23605341
3,4-dimethylpyrano[3,2-c]chromene-2,5-dione (PubChem CID 23605341) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3,4-dimethylpyrano[3,2-c]chromene-2,5-dione.
| Compound Name | 3,4-dimethylpyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 23605341 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3,4-dimethylpyrano[3,2-c]chromene-2,5-dione |
| SMILES | Cc1c(C)c2c(=O)oc3ccccc3c2oc1=O |
| InChI | InChI=1S/C14H10O4/c1-7-8(2)13(15)18-12-9-5-3-4-6-10(9)17-14(16)11(7)12/h3-6H,1-2H3 |
| InChIKey | GPZAYZGTVZXHCC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|