C11H6O3 — CID 1488785
furo[3,2-c]chromen-4-one (PubChem CID 1488785) has the molecular formula C11H6O3 and a molecular weight of 186.17 g/mol. Its IUPAC name is furo[3,2-c]chromen-4-one.
| Compound Name | furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 1488785 |
| Molecular Formula | C11H6O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | furo[3,2-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2occc12 |
| InChI | InChI=1S/C11H6O3/c12-11-8-5-6-13-10(8)7-3-1-2-4-9(7)14-11/h1-6H |
| InChIKey | PJSRBPQIBGEFRC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|