C11H6N2O2 — CID 691239
chromeno[3,4-b]pyrazin-5-one (PubChem CID 691239) has the molecular formula C11H6N2O2 and a molecular weight of 198.18 g/mol. Its IUPAC name is chromeno[3,4-b]pyrazin-5-one.
| Compound Name | chromeno[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 691239 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | chromeno[3,4-b]pyrazin-5-one |
| SMILES | O=c1oc2ccccc2c2nccnc12 |
| InChI | InChI=1S/C11H6N2O2/c14-11-10-9(12-5-6-13-10)7-3-1-2-4-8(7)15-11/h1-6H |
| InChIKey | NOVNOZNKFHLMJY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|