C13H9NO2 — CID 159288249
8-methylchromeno[4,3-b]pyridin-5-one (PubChem CID 159288249) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 8-methylchromeno[4,3-b]pyridin-5-one.
| Compound Name | 8-methylchromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 159288249 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 8-methylchromeno[4,3-b]pyridin-5-one |
| SMILES | Cc1ccc2c(c1)oc(=O)c1cccnc12 |
| InChI | InChI=1S/C13H9NO2/c1-8-4-5-9-11(7-8)16-13(15)10-3-2-6-14-12(9)10/h2-7H,1H3 |
| InChIKey | FIOUJLLHBCERJL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|