C30H21NO6 — CID 59746728
4-hydroxy-3-[(4-hydroxy-7-methyl-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-7-methylchromen-2-one (PubChem CID 59746728) has the molecular formula C30H21NO6 and a molecular weight of 491.50 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-7-methyl-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-7-methylchromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-7-methyl-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 59746728 |
| Molecular Formula | C30H21NO6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-7-methyl-2-oxochromen-3-yl)-quinolin-4-ylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(O)c(C(c3c(O)c4ccc(C)cc4oc3=O)c3ccnc4ccccc34)c(=O)oc2c1 |
| InChI | InChI=1S/C30H21NO6/c1-15-7-9-19-22(13-15)36-29(34)25(27(19)32)24(18-11-12-31-21-6-4-3-5-17(18)21)26-28(33)20-10-8-16(2)14-23(20)37-30(26)35/h3-14,24,32-33H,1-2H3 |
| InChIKey | MNBXJOPQZSEKPA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|