C24H15NO6 — CID 54682197
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-pyridin-2-ylmethyl]chromen-2-one (PubChem CID 54682197) has the molecular formula C24H15NO6 and a molecular weight of 413.39 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-pyridin-2-ylmethyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-pyridin-2-ylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 54682197 |
| Molecular Formula | C24H15NO6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-pyridin-2-ylmethyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccccn1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C24H15NO6/c26-21-13-7-1-3-10-16(13)30-23(28)19(21)18(15-9-5-6-12-25-15)20-22(27)14-8-2-4-11-17(14)31-24(20)29/h1-12,18,26-27H |
| InChIKey | ALIUDFBNLXBOKF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|