C25H16O8 — CID 54695589
3-[(3,4-dihydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 54695589) has the molecular formula C25H16O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(3,4-dihydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54695589 |
| Molecular Formula | C25H16O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccc(O)c(O)c1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H16O8/c26-15-10-9-12(11-16(15)27)19(20-22(28)13-5-1-3-7-17(13)32-24(20)30)21-23(29)14-6-2-4-8-18(14)33-25(21)31/h1-11,19,26-29H |
| InChIKey | ORWZLFWKVFUBIL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|