C31H20N2O7 — CID 137083141
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2-hydroxy-5-phenyldiazenylphenyl)methyl]chromen-2-one (PubChem CID 137083141) has the molecular formula C31H20N2O7 and a molecular weight of 532.51 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2-hydroxy-5-phenyldiazenylphenyl)methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2-hydroxy-5-phenyldiazenylphenyl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 137083141 |
| Molecular Formula | C31H20N2O7 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2-hydroxy-5-phenyldiazenylphenyl)methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1cc(/N=N/c2ccccc2)ccc1O)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C31H20N2O7/c34-22-15-14-18(33-32-17-8-2-1-3-9-17)16-21(22)25(26-28(35)19-10-4-6-12-23(19)39-30(26)37)27-29(36)20-11-5-7-13-24(20)40-31(27)38/h1-16,25,34-36H/b33-32+ |
| InChIKey | NKBYAQKVMNNGOW-ULIFNZDWSA-N |
| XLogP | 6.61 |
| TPSA | 145.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|