C26H15NO10 — CID 54675815
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]chromen-2-one (PubChem CID 54675815) has the molecular formula C26H15NO10 and a molecular weight of 501.40 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 54675815 |
| Molecular Formula | C26H15NO10 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1cc2c(cc1[N+](=O)[O-])OCO2)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C26H15NO10/c28-23-12-5-1-3-7-16(12)36-25(30)21(23)20(14-9-18-19(35-11-34-18)10-15(14)27(32)33)22-24(29)13-6-2-4-8-17(13)37-26(22)31/h1-10,20,28-29H,11H2 |
| InChIKey | IHCOPGSWOIAIJD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 162.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|