C30H31NO6 — CID 141484113
3-[(3,5-ditert-butyl-4-hydroxyphenyl)-(4-nitrophenyl)methyl]-4-hydroxychromen-2-one (PubChem CID 141484113) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)-(4-nitrophenyl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)-(4-nitrophenyl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 141484113 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)-(4-nitrophenyl)methyl]-4-hydroxychromen-2-one |
| SMILES | CC(C)(C)c1cc(C(c2ccc([N+](=O)[O-])cc2)c2c(O)c3ccccc3oc2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H31NO6/c1-29(2,3)21-15-18(16-22(27(21)33)30(4,5)6)24(17-11-13-19(14-12-17)31(35)36)25-26(32)20-9-7-8-10-23(20)37-28(25)34/h7-16,24,32-33H,1-6H3 |
| InChIKey | RUQZXVBAYBMJJE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|