C20H17NO6 — CID 54702817
4,7-dihydroxy-3-[3-methyl-1-(4-nitrophenyl)but-3-enyl]chromen-2-one (PubChem CID 54702817) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 4,7-dihydroxy-3-[3-methyl-1-(4-nitrophenyl)but-3-enyl]chromen-2-one.
| Compound Name | 4,7-dihydroxy-3-[3-methyl-1-(4-nitrophenyl)but-3-enyl]chromen-2-one |
|---|---|
| PubChem CID | 54702817 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4,7-dihydroxy-3-[3-methyl-1-(4-nitrophenyl)but-3-enyl]chromen-2-one |
| SMILES | C=C(C)CC(c1ccc([N+](=O)[O-])cc1)c1c(O)c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C20H17NO6/c1-11(2)9-16(12-3-5-13(6-4-12)21(25)26)18-19(23)15-8-7-14(22)10-17(15)27-20(18)24/h3-8,10,16,22-23H,1,9H2,2H3 |
| InChIKey | IGJVOMDZXKIHFI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|