C26H21N5O9 — CID 54747194
3-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-1-(4-nitrophenyl)pentyl]-4-hydroxychromen-2-one (PubChem CID 54747194) has the molecular formula C26H21N5O9 and a molecular weight of 547.48 g/mol. Its IUPAC name is 3-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-1-(4-nitrophenyl)pentyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-1-(4-nitrophenyl)pentyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54747194 |
| Molecular Formula | C26H21N5O9 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 3-[(3E)-3-[(2,4-dinitrophenyl)hydrazinylidene]-1-(4-nitrophenyl)pentyl]-4-hydroxychromen-2-one |
| SMILES | CC/C(CC(c1ccc([N+](=O)[O-])cc1)c1c(O)c2ccccc2oc1=O)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21N5O9/c1-2-16(27-28-21-12-11-18(30(36)37)14-22(21)31(38)39)13-20(15-7-9-17(10-8-15)29(34)35)24-25(32)19-5-3-4-6-23(19)40-26(24)33/h3-12,14,20,28,32H,2,13H2,1H3/b27-16+ |
| InChIKey | NHFVZKUTQCTNNP-JVWAILMASA-N |
| XLogP | 5.62 |
| TPSA | 204.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|