C27H26N2O5S — CID 54689792
N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 54689792) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54689792 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | CCC(CC(c1ccccc1)c1c(O)c2ccccc2oc1=O)=NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-20(28-29-35(32,33)21-15-13-18(2)14-16-21)17-23(19-9-5-4-6-10-19)25-26(30)22-11-7-8-12-24(22)34-27(25)31/h4-16,23,29-30H,3,17H2,1-2H3 |
| InChIKey | RBQYPGHHCBYNAV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|