C23H18FNO5S — CID 122225215
N-[(S)-(4-fluorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 122225215) has the molecular formula C23H18FNO5S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122225215 |
| Molecular Formula | C23H18FNO5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccc(F)cc2)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C23H18FNO5S/c1-14-6-12-17(13-7-14)31(28,29)25-21(15-8-10-16(24)11-9-15)20-22(26)18-4-2-3-5-19(18)30-23(20)27/h2-13,21,25-26H,1H3/t21-/m0/s1 |
| InChIKey | YXHYQAXLVSPCAV-NRFANRHFSA-N |
| XLogP | 4.01 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|