C31H33N3O5S — CID 98558444
N-[(Z)-[(1S)-1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 98558444) has the molecular formula C31H33N3O5S and a molecular weight of 559.69 g/mol. Its IUPAC name is N-[(Z)-[(1S)-1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(1S)-1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98558444 |
| Molecular Formula | C31H33N3O5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N-[(Z)-[(1S)-1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(\CCN2CCCC2)C[C@@H](c2ccccc2)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C31H33N3O5S/c1-22-13-15-25(16-14-22)40(37,38)33-32-24(17-20-34-18-7-8-19-34)21-27(23-9-3-2-4-10-23)29-30(35)26-11-5-6-12-28(26)39-31(29)36/h2-6,9-16,27,33,35H,7-8,17-21H2,1H3/b32-24+/t27-/m0/s1 |
| InChIKey | LDXLXWLEUWPCGQ-ZZBJEOSTSA-N |
| XLogP | 5.15 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|