C32H33N3O4 — CID 54704027
N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-2-phenylacetamide (PubChem CID 54704027) has the molecular formula C32H33N3O4 and a molecular weight of 523.63 g/mol. Its IUPAC name is N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-2-phenylacetamide.
| Compound Name | N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 54704027 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | N-[[1-(4-hydroxy-2-oxochromen-3-yl)-1-phenyl-5-pyrrolidin-1-ylpentan-3-ylidene]amino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN=C(CCN1CCCC1)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C32H33N3O4/c36-29(21-23-11-3-1-4-12-23)34-33-25(17-20-35-18-9-10-19-35)22-27(24-13-5-2-6-14-24)30-31(37)26-15-7-8-16-28(26)39-32(30)38/h1-8,11-16,27,37H,9-10,17-22H2,(H,34,36) |
| InChIKey | APBBCAWLTXBCGG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|