C24H26ClNO4 — CID 54695470
4-hydroxy-3-(3-oxo-1-phenyl-5-pyrrolidin-1-ylpentyl)chromen-2-one;hydrochloride (PubChem CID 54695470) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-hydroxy-3-(3-oxo-1-phenyl-5-pyrrolidin-1-ylpentyl)chromen-2-one;hydrochloride.
| Compound Name | 4-hydroxy-3-(3-oxo-1-phenyl-5-pyrrolidin-1-ylpentyl)chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 54695470 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-hydroxy-3-(3-oxo-1-phenyl-5-pyrrolidin-1-ylpentyl)chromen-2-one;hydrochloride |
| SMILES | Cl.O=C(CCN1CCCC1)CC(c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C24H25NO4.ClH/c26-18(12-15-25-13-6-7-14-25)16-20(17-8-2-1-3-9-17)22-23(27)19-10-4-5-11-21(19)29-24(22)28;/h1-5,8-11,20,27H,6-7,12-16H2;1H |
| InChIKey | YQZRPJJHKYZKMY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|