C36H43N3O4 — CID 124635299
N-[(Z)-[(3S,4S)-3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]-2-phenylacetamide (PubChem CID 124635299) has the molecular formula C36H43N3O4 and a molecular weight of 581.76 g/mol. Its IUPAC name is N-[(Z)-[(3S,4S)-3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]-2-phenylacetamide.
| Compound Name | N-[(Z)-[(3S,4S)-3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 124635299 |
| Molecular Formula | C36H43N3O4 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | N-[(Z)-[(3S,4S)-3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]-2-phenylacetamide |
| SMILES | C/C(=N/NC(=O)Cc1ccccc1)[C@H](CN(CC(C)C)CC(C)C)[C@@H](c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C36H43N3O4/c1-24(2)21-39(22-25(3)4)23-30(26(5)37-38-32(40)20-27-14-8-6-9-15-27)33(28-16-10-7-11-17-28)34-35(41)29-18-12-13-19-31(29)43-36(34)42/h6-19,24-25,30,33,41H,20-23H2,1-5H3,(H,38,40)/b37-26-/t30-,33+/m0/s1 |
| InChIKey | KGCNMUPIDXGGMU-DRIKMOJOSA-N |
| XLogP | 6.60 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|