C28H35NO4 — CID 92857666
3-[(1S,2R)-2-[[bis(2-methylpropyl)amino]methyl]-3-oxo-1-phenylbutyl]-4-hydroxychromen-2-one (PubChem CID 92857666) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is 3-[(1S,2R)-2-[[bis(2-methylpropyl)amino]methyl]-3-oxo-1-phenylbutyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(1S,2R)-2-[[bis(2-methylpropyl)amino]methyl]-3-oxo-1-phenylbutyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 92857666 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 3-[(1S,2R)-2-[[bis(2-methylpropyl)amino]methyl]-3-oxo-1-phenylbutyl]-4-hydroxychromen-2-one |
| SMILES | CC(=O)[C@@H](CN(CC(C)C)CC(C)C)[C@@H](c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H35NO4/c1-18(2)15-29(16-19(3)4)17-23(20(5)30)25(21-11-7-6-8-12-21)26-27(31)22-13-9-10-14-24(22)33-28(26)32/h6-14,18-19,23,25,31H,15-17H2,1-5H3/t23-,25-/m1/s1 |
| InChIKey | WLJJKQXSWXBIGG-ILBGXUMGSA-N |
| XLogP | 5.45 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|