C24H29N3O3 — CID 98558533
3-[(1S,2R,3E)-2-[(dimethylamino)methyl]-3-(dimethylhydrazinylidene)-1-phenylbutyl]-4-hydroxychromen-2-one (PubChem CID 98558533) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[(1S,2R,3E)-2-[(dimethylamino)methyl]-3-(dimethylhydrazinylidene)-1-phenylbutyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(1S,2R,3E)-2-[(dimethylamino)methyl]-3-(dimethylhydrazinylidene)-1-phenylbutyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 98558533 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[(1S,2R,3E)-2-[(dimethylamino)methyl]-3-(dimethylhydrazinylidene)-1-phenylbutyl]-4-hydroxychromen-2-one |
| SMILES | C/C(=N\N(C)C)[C@@H](CN(C)C)[C@@H](c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C24H29N3O3/c1-16(25-27(4)5)19(15-26(2)3)21(17-11-7-6-8-12-17)22-23(28)18-13-9-10-14-20(18)30-24(22)29/h6-14,19,21,28H,15H2,1-5H3/b25-16+/t19-,21-/m1/s1 |
| InChIKey | UCGJQBNQOAVGBX-VHWQSMPPSA-N |
| XLogP | 3.75 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|