C29H39N5O3 — CID 54720460
2-[[3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]guanidine (PubChem CID 54720460) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[[3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]guanidine.
| Compound Name | 2-[[3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 54720460 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 2-[[3-[[bis(2-methylpropyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]guanidine |
| SMILES | CC(=NN=C(N)N)C(CN(CC(C)C)CC(C)C)C(c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C29H39N5O3/c1-18(2)15-34(16-19(3)4)17-23(20(5)32-33-29(30)31)25(21-11-7-6-8-12-21)26-27(35)22-13-9-10-14-24(22)37-28(26)36/h6-14,18-19,23,25,35H,15-17H2,1-5H3,(H4,30,31,33) |
| InChIKey | WUXKBQSQNLFGIO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|