C28H35N3O5 — CID 92838164
methyl N-[(Z)-[(3R,4S)-3-[[butyl(ethyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]carbamate (PubChem CID 92838164) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl N-[(Z)-[(3R,4S)-3-[[butyl(ethyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]carbamate.
| Compound Name | methyl N-[(Z)-[(3R,4S)-3-[[butyl(ethyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 92838164 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | methyl N-[(Z)-[(3R,4S)-3-[[butyl(ethyl)amino]methyl]-4-(4-hydroxy-2-oxochromen-3-yl)-4-phenylbutan-2-ylidene]amino]carbamate |
| SMILES | CCCCN(CC)C[C@H](/C(C)=N\NC(=O)OC)[C@@H](c1ccccc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H35N3O5/c1-5-7-17-31(6-2)18-22(19(3)29-30-28(34)35-4)24(20-13-9-8-10-14-20)25-26(32)21-15-11-12-16-23(21)36-27(25)33/h8-16,22,24,32H,5-7,17-18H2,1-4H3,(H,30,34)/b29-19-/t22-,24-/m1/s1 |
| InChIKey | NFSLTZOYMBCKMZ-UNFLZWPASA-N |
| XLogP | 5.10 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|