C27H19NO7 — CID 58550677
N-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]acetamide (PubChem CID 58550677) has the molecular formula C27H19NO7 and a molecular weight of 469.45 g/mol. Its IUPAC name is N-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]acetamide.
| Compound Name | N-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58550677 |
| Molecular Formula | C27H19NO7 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C27H19NO7/c1-14(29)28-16-12-10-15(11-13-16)21(22-24(30)17-6-2-4-8-19(17)34-26(22)32)23-25(31)18-7-3-5-9-20(18)35-27(23)33/h2-13,21,30-31H,1H3,(H,28,29) |
| InChIKey | RRFMEMBFUWPILY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|