C36H24O12 — CID 54681863
[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,4-diacetyloxybenzoate (PubChem CID 54681863) has the molecular formula C36H24O12 and a molecular weight of 648.58 g/mol. Its IUPAC name is [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,4-diacetyloxybenzoate.
| Compound Name | [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,4-diacetyloxybenzoate |
|---|---|
| PubChem CID | 54681863 |
| Molecular Formula | C36H24O12 |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,4-diacetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)Oc2ccc(C(c3c(O)c4ccccc4oc3=O)c3c(O)c4ccccc4oc3=O)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C36H24O12/c1-18(37)44-27-16-13-21(17-28(27)45-19(2)38)34(41)46-22-14-11-20(12-15-22)29(30-32(39)23-7-3-5-9-25(23)47-35(30)42)31-33(40)24-8-4-6-10-26(24)48-36(31)43/h3-17,29,39-40H,1-2H3 |
| InChIKey | MMVRXDQRRVRSLI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|