About [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate
[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate (PubChem CID 54713590) has the molecular formula C36H24O12
and a molecular weight of 648.58 g/mol. Its IUPAC name is [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate.
Molecular Properties
| Compound Name | [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate |
| PubChem CID | 54713590 |
| Molecular Formula | C36H24O12 |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)Oc2ccc(C(c3c(O)c4ccccc4oc3=O)c3c(O)c4ccccc4oc3=O)cc2)c1 |
| InChI | InChI=1S/C36H24O12/c1-18(37)44-23-15-21(16-24(17-23)45-19(2)38)34(41)46-22-13-11-20(12-14-22)29(30-32(39)25-7-3-5-9-27(25)47-35(30)42)31-33(40)26-8-4-6-10-28(26)48-36(31)43/h3-17,29,39-40H,1-2H3 |
| InChIKey | OQHPXJWKCGBOFD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate?
The IUPAC name of [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate (CID 54713590) is [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate.
What is the SMILES notation for [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate?
The canonical SMILES for [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate is CC(=O)Oc1cc(OC(C)=O)cc(C(=O)Oc2ccc(C(c3c(O)c4ccccc4oc3=O)c3c(O)c4ccccc4oc3=O)cc2)c1.
What is the InChIKey of [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate?
The InChIKey is OQHPXJWKCGBOFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H24O12/c1-18(37)44-23-15-21(16-24(17-23)45-19(2)38)34(41)46-22-13-11-20(12-14-22)29(30-32(39)25-7-3-5-9-27(25)47-35(30)42)31-33(40)26-8-4-6-10-28(26)48-36(31)43/h3-17,29,39-40H,1-2H3.
What are the key properties of [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate?
[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate has a molecular weight of 648.58 g/mol, XLogP of 5.56, 7 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl] 3,5-diacetyloxybenzoate is sourced from PubChem (CID 54713590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).