C33H24N2O7S — CID 118855512
1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 118855512) has the molecular formula C33H24N2O7S and a molecular weight of 592.63 g/mol. Its IUPAC name is 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 118855512 |
| Molecular Formula | C33H24N2O7S |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(C(c3c(O)c4ccccc4oc3=O)c3c(O)c4ccccc4oc3=O)cc2)cc1 |
| InChI | InChI=1S/C33H24N2O7S/c1-40-21-16-14-20(15-17-21)35-33(43)34-19-12-10-18(11-13-19)26(27-29(36)22-6-2-4-8-24(22)41-31(27)38)28-30(37)23-7-3-5-9-25(23)42-32(28)39/h2-17,26,36-37H,1H3,(H2,34,35,43) |
| InChIKey | MKCNPMHDIULUEF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|