C32H21BrN2O6S — CID 118855499
1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea (PubChem CID 118855499) has the molecular formula C32H21BrN2O6S and a molecular weight of 641.50 g/mol. Its IUPAC name is 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea.
| Compound Name | 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea |
|---|---|
| PubChem CID | 118855499 |
| Molecular Formula | C32H21BrN2O6S |
| Molecular Weight | 641.50 g/mol |
| Exact Mass | 640.03 |
| IUPAC Name | 1-[4-[bis(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1ccc(NC(=S)Nc2cccc(Br)c2)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C32H21BrN2O6S/c33-18-6-5-7-20(16-18)35-32(42)34-19-14-12-17(13-15-19)25(26-28(36)21-8-1-3-10-23(21)40-30(26)38)27-29(37)22-9-2-4-11-24(22)41-31(27)39/h1-16,25,36-37H,(H2,34,35,42) |
| InChIKey | DAOFEZRSCIGLHQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|