C32H27BrN4S — CID 91937836
1-[4-[bis(7-methyl-1H-indol-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea (PubChem CID 91937836) has the molecular formula C32H27BrN4S and a molecular weight of 579.57 g/mol. Its IUPAC name is 1-[4-[bis(7-methyl-1H-indol-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea.
| Compound Name | 1-[4-[bis(7-methyl-1H-indol-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea |
|---|---|
| PubChem CID | 91937836 |
| Molecular Formula | C32H27BrN4S |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 1-[4-[bis(7-methyl-1H-indol-3-yl)methyl]phenyl]-3-(3-bromophenyl)thiourea |
| SMILES | Cc1cccc2c(C(c3ccc(NC(=S)Nc4cccc(Br)c4)cc3)c3c[nH]c4c(C)cccc34)c[nH]c12 |
| InChI | InChI=1S/C32H27BrN4S/c1-19-6-3-10-25-27(17-34-30(19)25)29(28-18-35-31-20(2)7-4-11-26(28)31)21-12-14-23(15-13-21)36-32(38)37-24-9-5-8-22(33)16-24/h3-18,29,34-35H,1-2H3,(H2,36,37,38) |
| InChIKey | MSGXGTRDMVUSQC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|