C15H15BrN2S — CID 9234877
1-(3-bromophenyl)-3-(2,6-dimethylphenyl)thiourea (PubChem CID 9234877) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 9234877 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrN2S/c1-10-5-3-6-11(2)14(10)18-15(19)17-13-8-4-7-12(16)9-13/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | JZKSYGUOOXNBEP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|