C15H16BrN3O2S2 — CID 9237503
1-(3-bromophenyl)-3-[4-methyl-3-(methylsulfamoyl)phenyl]thiourea (PubChem CID 9237503) has the molecular formula C15H16BrN3O2S2 and a molecular weight of 414.35 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[4-methyl-3-(methylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[4-methyl-3-(methylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 9237503 |
| Molecular Formula | C15H16BrN3O2S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 1-(3-bromophenyl)-3-[4-methyl-3-(methylsulfamoyl)phenyl]thiourea |
| SMILES | CNS(=O)(=O)c1cc(NC(=S)Nc2cccc(Br)c2)ccc1C |
| InChI | InChI=1S/C15H16BrN3O2S2/c1-10-6-7-13(9-14(10)23(20,21)17-2)19-15(22)18-12-5-3-4-11(16)8-12/h3-9,17H,1-2H3,(H2,18,19,22) |
| InChIKey | DYESSZPKXJVGPX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|