C25H14Br2O7 — CID 54732573
3-[(3,5-dibromo-2-hydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 54732573) has the molecular formula C25H14Br2O7 and a molecular weight of 586.19 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-hydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(3,5-dibromo-2-hydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54732573 |
| Molecular Formula | C25H14Br2O7 |
| Molecular Weight | 586.19 g/mol |
| Exact Mass | 583.91 |
| IUPAC Name | 3-[(3,5-dibromo-2-hydroxyphenyl)-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1cc(Br)cc(Br)c1O)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H14Br2O7/c26-11-9-14(21(28)15(27)10-11)18(19-22(29)12-5-1-3-7-16(12)33-24(19)31)20-23(30)13-6-2-4-8-17(13)34-25(20)32/h1-10,18,28-30H |
| InChIKey | CEMHHBKMGGBSJS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.19 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|