C28H17BrN2O6 — CID 54679848
3-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one (PubChem CID 54679848) has the molecular formula C28H17BrN2O6 and a molecular weight of 557.36 g/mol. Its IUPAC name is 3-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54679848 |
| Molecular Formula | C28H17BrN2O6 |
| Molecular Weight | 557.36 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | 3-[[5-(4-bromophenyl)-1H-pyrazol-4-yl]-(4-hydroxy-2-oxochromen-3-yl)methyl]-4-hydroxychromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1cn[nH]c1-c1ccc(Br)cc1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H17BrN2O6/c29-15-11-9-14(10-12-15)24-18(13-30-31-24)21(22-25(32)16-5-1-3-7-19(16)36-27(22)34)23-26(33)17-6-2-4-8-20(17)37-28(23)35/h1-13,21,32-33H,(H,30,31) |
| InChIKey | GVXZTKHJRYYZMS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|