C28H22O9 — CID 54725152
4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2,3,4-trimethoxyphenyl)methyl]chromen-2-one (PubChem CID 54725152) has the molecular formula C28H22O9 and a molecular weight of 502.48 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2,3,4-trimethoxyphenyl)methyl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2,3,4-trimethoxyphenyl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 54725152 |
| Molecular Formula | C28H22O9 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)-(2,3,4-trimethoxyphenyl)methyl]chromen-2-one |
| SMILES | COc1ccc(C(c2c(O)c3ccccc3oc2=O)c2c(O)c3ccccc3oc2=O)c(OC)c1OC |
| InChI | InChI=1S/C28H22O9/c1-33-19-13-12-16(25(34-2)26(19)35-3)20(21-23(29)14-8-4-6-10-17(14)36-27(21)31)22-24(30)15-9-5-7-11-18(15)37-28(22)32/h4-13,20,29-30H,1-3H3 |
| InChIKey | GHWDQEFDAHDHTQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|