C24H20O5S — CID 102120330
3-[(3,4-dimethoxyphenyl)-phenylsulfanylmethyl]-4-hydroxychromen-2-one (PubChem CID 102120330) has the molecular formula C24H20O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)-phenylsulfanylmethyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(3,4-dimethoxyphenyl)-phenylsulfanylmethyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 102120330 |
| Molecular Formula | C24H20O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)-phenylsulfanylmethyl]-4-hydroxychromen-2-one |
| SMILES | COc1ccc(C(Sc2ccccc2)c2c(O)c3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C24H20O5S/c1-27-19-13-12-15(14-20(19)28-2)23(30-16-8-4-3-5-9-16)21-22(25)17-10-6-7-11-18(17)29-24(21)26/h3-14,23,25H,1-2H3 |
| InChIKey | IHVQIPQNHYQWPI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|