About methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate
methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate (PubChem CID 124879262) has the molecular formula C21H20O7
and a molecular weight of 384.38 g/mol. Its IUPAC name is methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate |
| PubChem CID | 124879262 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(OC)c(OC)c1)c1oc2ccccc2c(=O)c1O |
| InChI | InChI=1S/C21H20O7/c1-25-16-9-8-12(10-17(16)26-2)14(11-18(22)27-3)21-20(24)19(23)13-6-4-5-7-15(13)28-21/h4-10,14,24H,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | RGCRGNIEZGVGQE-AWEZNQCLSA-N |
| XLogP | 3.21 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate?
The IUPAC name of methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate (CID 124879262) is methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate.
What is the SMILES notation for methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate?
The canonical SMILES for methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate is COC(=O)C[C@@H](c1ccc(OC)c(OC)c1)c1oc2ccccc2c(=O)c1O.
What is the InChIKey of methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate?
The InChIKey is RGCRGNIEZGVGQE-AWEZNQCLSA-N. The full InChI is InChI=1S/C21H20O7/c1-25-16-9-8-12(10-17(16)26-2)14(11-18(22)27-3)21-20(24)19(23)13-6-4-5-7-15(13)28-21/h4-10,14,24H,11H2,1-3H3/t14-/m0/s1.
What are the key properties of methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate?
methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate has a molecular weight of 384.38 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-(3,4-dimethoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate is sourced from PubChem (CID 124879262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).