C20H18O7 — CID 124879464
methyl (3S)-3-(4-hydroxy-3-methoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate (PubChem CID 124879464) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl (3S)-3-(4-hydroxy-3-methoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate.
| Compound Name | methyl (3S)-3-(4-hydroxy-3-methoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate |
|---|---|
| PubChem CID | 124879464 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl (3S)-3-(4-hydroxy-3-methoxyphenyl)-3-(3-hydroxy-4-oxochromen-2-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(O)c(OC)c1)c1oc2ccccc2c(=O)c1O |
| InChI | InChI=1S/C20H18O7/c1-25-16-9-11(7-8-14(16)21)13(10-17(22)26-2)20-19(24)18(23)12-5-3-4-6-15(12)27-20/h3-9,13,21,24H,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | TUUFGXFEYRBKRK-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |