C17H20O5 — CID 124879530
methyl (3S)-3-(3-hydroxy-4-oxochromen-2-yl)-5-methylhexanoate (PubChem CID 124879530) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl (3S)-3-(3-hydroxy-4-oxochromen-2-yl)-5-methylhexanoate.
| Compound Name | methyl (3S)-3-(3-hydroxy-4-oxochromen-2-yl)-5-methylhexanoate |
|---|---|
| PubChem CID | 124879530 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | methyl (3S)-3-(3-hydroxy-4-oxochromen-2-yl)-5-methylhexanoate |
| SMILES | COC(=O)C[C@H](CC(C)C)c1oc2ccccc2c(=O)c1O |
| InChI | InChI=1S/C17H20O5/c1-10(2)8-11(9-14(18)21-3)17-16(20)15(19)12-6-4-5-7-13(12)22-17/h4-7,10-11,20H,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | UJAXRMHIZPQSDC-NSHDSACASA-N |
| XLogP | 3.19 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |