C23H24O7 — CID 97487762
methyl (3R)-5-methyl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)hexanoate (PubChem CID 97487762) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl (3R)-5-methyl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)hexanoate.
| Compound Name | methyl (3R)-5-methyl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)hexanoate |
|---|---|
| PubChem CID | 97487762 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl (3R)-5-methyl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)hexanoate |
| SMILES | COC(=O)C[C@@H](CC(C)C)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C23H24O7/c1-12(2)9-14(10-17(25)29-3)18-20(26)22(28)21(27)19-15(24)11-16(30-23(18)19)13-7-5-4-6-8-13/h4-8,11-12,14,26-28H,9-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | HFGBAMKFULJEDN-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|