C25H18F2O7 — CID 97488210
methyl (3R)-3-(3,4-difluorophenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 97488210) has the molecular formula C25H18F2O7 and a molecular weight of 468.41 g/mol. Its IUPAC name is methyl (3R)-3-(3,4-difluorophenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl (3R)-3-(3,4-difluorophenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 97488210 |
| Molecular Formula | C25H18F2O7 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | methyl (3R)-3-(3,4-difluorophenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1ccc(F)c(F)c1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C25H18F2O7/c1-33-19(29)10-14(13-7-8-15(26)16(27)9-13)20-22(30)24(32)23(31)21-17(28)11-18(34-25(20)21)12-5-3-2-4-6-12/h2-9,11,14,30-32H,10H2,1H3/t14-/m1/s1 |
| InChIKey | NECWPYLLBNSCOS-CQSZACIVSA-N |
| XLogP | 4.55 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|