C30H28O9 — CID 98885665
methyl (3R)-3-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 98885665) has the molecular formula C30H28O9 and a molecular weight of 532.55 g/mol. Its IUPAC name is methyl (3R)-3-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl (3R)-3-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 98885665 |
| Molecular Formula | C30H28O9 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | methyl (3R)-3-[4-methoxy-3-(2-methylprop-2-enoxy)phenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | C=C(C)COc1cc([C@@H](CC(=O)OC)c2c(O)c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)ccc1OC |
| InChI | InChI=1S/C30H28O9/c1-16(2)15-38-23-12-18(10-11-21(23)36-3)19(13-24(32)37-4)25-27(33)29(35)28(34)26-20(31)14-22(39-30(25)26)17-8-6-5-7-9-17/h5-12,14,19,33-35H,1,13,15H2,2-4H3/t19-/m1/s1 |
| InChIKey | HGQPXDPYODWARJ-LJQANCHMSA-N |
| XLogP | 5.24 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|