C36H32O10 — CID 75492258
methyl 3-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 75492258) has the molecular formula C36H32O10 and a molecular weight of 624.64 g/mol. Its IUPAC name is methyl 3-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl 3-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 75492258 |
| Molecular Formula | C36H32O10 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | methyl 3-[4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-methoxyphenyl]-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OCCc2ccc3c(c2)CCO3)c(OC)c1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C36H32O10/c1-42-29-17-22(9-11-27(29)45-14-12-20-8-10-26-23(16-20)13-15-44-26)24(18-30(38)43-2)31-33(39)35(41)34(40)32-25(37)19-28(46-36(31)32)21-6-4-3-5-7-21/h3-11,16-17,19,24,39-41H,12-15,18H2,1-2H3 |
| InChIKey | KGMZHSSDEBMPHL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|