C29H27NO9 — CID 91637298
5,6,7-trihydroxy-8-[1-(3-hydroxy-4-methoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one (PubChem CID 91637298) has the molecular formula C29H27NO9 and a molecular weight of 533.53 g/mol. Its IUPAC name is 5,6,7-trihydroxy-8-[1-(3-hydroxy-4-methoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one.
| Compound Name | 5,6,7-trihydroxy-8-[1-(3-hydroxy-4-methoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 91637298 |
| Molecular Formula | C29H27NO9 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 5,6,7-trihydroxy-8-[1-(3-hydroxy-4-methoxyphenyl)-3-morpholin-4-yl-3-oxopropyl]-2-phenylchromen-4-one |
| SMILES | COc1ccc(C(CC(=O)N2CCOCC2)c2c(O)c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)cc1O |
| InChI | InChI=1S/C29H27NO9/c1-37-21-8-7-17(13-19(21)31)18(14-23(33)30-9-11-38-12-10-30)24-26(34)28(36)27(35)25-20(32)15-22(39-29(24)25)16-5-3-2-4-6-16/h2-8,13,15,18,31,34-36H,9-12,14H2,1H3 |
| InChIKey | XLXAVJCMDTYKDZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 149.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|