C26H22O9 — CID 97488005
methyl (3R)-3-(3-hydroxy-4-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 97488005) has the molecular formula C26H22O9 and a molecular weight of 478.45 g/mol. Its IUPAC name is methyl (3R)-3-(3-hydroxy-4-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl (3R)-3-(3-hydroxy-4-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 97488005 |
| Molecular Formula | C26H22O9 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl (3R)-3-(3-hydroxy-4-methoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1ccc(OC)c(O)c1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C26H22O9/c1-33-18-9-8-14(10-16(18)27)15(11-20(29)34-2)21-23(30)25(32)24(31)22-17(28)12-19(35-26(21)22)13-6-4-3-5-7-13/h3-10,12,15,27,30-32H,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | XNSFJGCTDFIGNW-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|