C23H18O7S — CID 75492147
methyl 3-thiophen-3-yl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 75492147) has the molecular formula C23H18O7S and a molecular weight of 438.46 g/mol. Its IUPAC name is methyl 3-thiophen-3-yl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl 3-thiophen-3-yl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 75492147 |
| Molecular Formula | C23H18O7S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | methyl 3-thiophen-3-yl-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)CC(c1ccsc1)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C23H18O7S/c1-29-17(25)9-14(13-7-8-31-11-13)18-20(26)22(28)21(27)19-15(24)10-16(30-23(18)19)12-5-3-2-4-6-12/h2-8,10-11,14,26-28H,9H2,1H3 |
| InChIKey | UTWPTPMKMRQBNF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|