C28H26O10 — CID 97488332
methyl (3R)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)-3-(2,4,5-trimethoxyphenyl)propanoate (PubChem CID 97488332) has the molecular formula C28H26O10 and a molecular weight of 522.51 g/mol. Its IUPAC name is methyl (3R)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)-3-(2,4,5-trimethoxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)-3-(2,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 97488332 |
| Molecular Formula | C28H26O10 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | methyl (3R)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)-3-(2,4,5-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](c1cc(OC)c(OC)cc1OC)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C28H26O10/c1-34-19-13-21(36-3)20(35-2)10-15(19)16(11-22(30)37-4)23-25(31)27(33)26(32)24-17(29)12-18(38-28(23)24)14-8-6-5-7-9-14/h5-10,12-13,16,31-33H,11H2,1-4H3/t16-/m1/s1 |
| InChIKey | XJXIEABGQBHTMS-MRXNPFEDSA-N |
| XLogP | 4.30 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|