C27H24O9 — CID 97488874
methyl (3R)-3-(2,3-dimethoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate (PubChem CID 97488874) has the molecular formula C27H24O9 and a molecular weight of 492.48 g/mol. Its IUPAC name is methyl (3R)-3-(2,3-dimethoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate.
| Compound Name | methyl (3R)-3-(2,3-dimethoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
|---|---|
| PubChem CID | 97488874 |
| Molecular Formula | C27H24O9 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | methyl (3R)-3-(2,3-dimethoxyphenyl)-3-(5,6,7-trihydroxy-4-oxo-2-phenylchromen-8-yl)propanoate |
| SMILES | COC(=O)C[C@H](c1cccc(OC)c1OC)c1c(O)c(O)c(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C27H24O9/c1-33-18-11-7-10-15(26(18)35-3)16(12-20(29)34-2)21-23(30)25(32)24(31)22-17(28)13-19(36-27(21)22)14-8-5-4-6-9-14/h4-11,13,16,30-32H,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | KBKADLOOGWIJBI-MRXNPFEDSA-N |
| XLogP | 4.29 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|